About ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene
ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene (PubChem CID 171088384) has the molecular formula C23H28O2
and a molecular weight of 336.48 g/mol. Its IUPAC name is ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene.
Molecular Properties
| Compound Name | ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene |
| PubChem CID | 171088384 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene |
| SMILES | CC.CC1=Cc2ccccc2OC1.CCC1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C11H12O.C10H10O.C2H6/c1-2-9-7-10-5-3-4-6-11(10)12-8-9;1-8-6-9-4-2-3-5-10(9)11-7-8;1-2/h3-7H,2,8H2,1H3;2-6H,7H2,1H3;1-2H3 |
| InChIKey | AFXHQQBMZMTBMY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene?
The IUPAC name of ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene (CID 171088384) is ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene.
What is the SMILES notation for ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene?
The canonical SMILES for ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene is CC.CC1=Cc2ccccc2OC1.CCC1=Cc2ccccc2OC1.
What is the InChIKey of ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene?
The InChIKey is AFXHQQBMZMTBMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O.C10H10O.C2H6/c1-2-9-7-10-5-3-4-6-11(10)12-8-9;1-8-6-9-4-2-3-5-10(9)11-7-8;1-2/h3-7H,2,8H2,1H3;2-6H,7H2,1H3;1-2H3.
What are the key properties of ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene?
ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene has a molecular weight of 336.48 g/mol, XLogP of 6.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-2H-chromene;3-methyl-2H-chromene is sourced from PubChem (CID 171088384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).