About 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane
6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane (PubChem CID 171089738) has the molecular formula C18H28N2
and a molecular weight of 272.44 g/mol. Its IUPAC name is 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane.
Molecular Properties
| Compound Name | 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane |
| PubChem CID | 171089738 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane |
| SMILES | CCC(C)C.CCc1c(C)cc2c(N)nccc2c1C |
| InChI | InChI=1S/C13H16N2.C5H12/c1-4-10-8(2)7-12-11(9(10)3)5-6-15-13(12)14;1-4-5(2)3/h5-7H,4H2,1-3H3,(H2,14,15);5H,4H2,1-3H3 |
| InChIKey | DKPUMMSLEQWNHF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane?
The IUPAC name of 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane (CID 171089738) is 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane.
What is the SMILES notation for 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane?
The canonical SMILES for 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane is CCC(C)C.CCc1c(C)cc2c(N)nccc2c1C.
What is the InChIKey of 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane?
The InChIKey is DKPUMMSLEQWNHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2.C5H12/c1-4-10-8(2)7-12-11(9(10)3)5-6-15-13(12)14;1-4-5(2)3/h5-7H,4H2,1-3H3,(H2,14,15);5H,4H2,1-3H3.
What are the key properties of 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane?
6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane has a molecular weight of 272.44 g/mol, XLogP of 5.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-5,7-dimethylisoquinolin-1-amine;2-methylbutane is sourced from PubChem (CID 171089738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).