C25H23F6N5O — CID 171089976
(E)-3-amino-N-[(1-amino-5,7-dimethylisoquinolin-6-yl)methyl]-2-[[3,5-bis(trifluoromethyl)phenyl]methyliminomethyl]prop-2-enamide (PubChem CID 171089976) has the molecular formula C25H23F6N5O and a molecular weight of 523.48 g/mol. Its IUPAC name is (E)-3-amino-N-[(1-amino-5,7-dimethylisoquinolin-6-yl)methyl]-2-[[3,5-bis(trifluoromethyl)phenyl]methyliminomethyl]prop-2-enamide.
| Compound Name | (E)-3-amino-N-[(1-amino-5,7-dimethylisoquinolin-6-yl)methyl]-2-[[3,5-bis(trifluoromethyl)phenyl]methyliminomethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171089976 |
| Molecular Formula | C25H23F6N5O |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | (E)-3-amino-N-[(1-amino-5,7-dimethylisoquinolin-6-yl)methyl]-2-[[3,5-bis(trifluoromethyl)phenyl]methyliminomethyl]prop-2-enamide |
| SMILES | Cc1cc2c(N)nccc2c(C)c1CNC(=O)C(/C=N/Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)=C/N |
| InChI | InChI=1S/C25H23F6N5O/c1-13-5-20-19(3-4-35-22(20)33)14(2)21(13)12-36-23(37)16(9-32)11-34-10-15-6-17(24(26,27)28)8-18(7-15)25(29,30)31/h3-9,11H,10,12,32H2,1-2H3,(H2,33,35)(H,36,37)/b16-9+,34-11+ |
| InChIKey | YTLLFILLYIVCFQ-WETDIZSSSA-N |
| XLogP | 5.20 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|