C26H26N6O2 — CID 171090129
(E)-3-amino-N-[(1-amino-5,7-dimethylisoquinolin-6-yl)methyl]-2-[(3-hydroxyquinolin-6-yl)methyliminomethyl]prop-2-enamide (PubChem CID 171090129) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is (E)-3-amino-N-[(1-amino-5,7-dimethylisoquinolin-6-yl)methyl]-2-[(3-hydroxyquinolin-6-yl)methyliminomethyl]prop-2-enamide.
| Compound Name | (E)-3-amino-N-[(1-amino-5,7-dimethylisoquinolin-6-yl)methyl]-2-[(3-hydroxyquinolin-6-yl)methyliminomethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171090129 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (E)-3-amino-N-[(1-amino-5,7-dimethylisoquinolin-6-yl)methyl]-2-[(3-hydroxyquinolin-6-yl)methyliminomethyl]prop-2-enamide |
| SMILES | Cc1cc2c(N)nccc2c(C)c1CNC(=O)C(/C=N/Cc1ccc2ncc(O)cc2c1)=C/N |
| InChI | InChI=1S/C26H26N6O2/c1-15-7-22-21(5-6-30-25(22)28)16(2)23(15)14-32-26(34)19(10-27)12-29-11-17-3-4-24-18(8-17)9-20(33)13-31-24/h3-10,12-13,33H,11,14,27H2,1-2H3,(H2,28,30)(H,32,34)/b19-10+,29-12+ |
| InChIKey | UMHKIMLVCCGRLS-LHZFHFBSSA-N |
| XLogP | 3.42 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|