C15H17ClN4O — CID 171090246
(1E,3E)-1-chloro-3-[(2,3-dimethylquinoxalin-6-yl)methoxy]buta-1,3-diene-1,4-diamine (PubChem CID 171090246) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is (1E,3E)-1-chloro-3-[(2,3-dimethylquinoxalin-6-yl)methoxy]buta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3E)-1-chloro-3-[(2,3-dimethylquinoxalin-6-yl)methoxy]buta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 171090246 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (1E,3E)-1-chloro-3-[(2,3-dimethylquinoxalin-6-yl)methoxy]buta-1,3-diene-1,4-diamine |
| SMILES | Cc1nc2ccc(COC(/C=C(\N)Cl)=C/N)cc2nc1C |
| InChI | InChI=1S/C15H17ClN4O/c1-9-10(2)20-14-5-11(3-4-13(14)19-9)8-21-12(7-17)6-15(16)18/h3-7H,8,17-18H2,1-2H3/b12-7+,15-6- |
| InChIKey | BAUOTMNVBYQXCR-OXFBFARJSA-N |
| XLogP | 2.60 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|