C17H15ClN4 — CID 171090359
6-chloro-N-[(3-cyclopropylquinolin-6-yl)methyl]pyrimidin-4-amine (PubChem CID 171090359) has the molecular formula C17H15ClN4 and a molecular weight of 310.79 g/mol. Its IUPAC name is 6-chloro-N-[(3-cyclopropylquinolin-6-yl)methyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(3-cyclopropylquinolin-6-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 171090359 |
| Molecular Formula | C17H15ClN4 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 6-chloro-N-[(3-cyclopropylquinolin-6-yl)methyl]pyrimidin-4-amine |
| SMILES | Clc1cc(NCc2ccc3ncc(C4CC4)cc3c2)ncn1 |
| InChI | InChI=1S/C17H15ClN4/c18-16-7-17(22-10-21-16)20-8-11-1-4-15-13(5-11)6-14(9-19-15)12-2-3-12/h1,4-7,9-10,12H,2-3,8H2,(H,20,21,22) |
| InChIKey | RUBATLHFAFHZIA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |