About ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one
ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one (PubChem CID 171092267) has the molecular formula C18H22N2O
and a molecular weight of 282.39 g/mol. Its IUPAC name is ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one.
Molecular Properties
| Compound Name | ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one |
| PubChem CID | 171092267 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one |
| SMILES | C=c1cc2c(nc1=C)-c1cc(C)c(CC)c(=O)n1C2.CC |
| InChI | InChI=1S/C16H16N2O.C2H6/c1-5-13-10(3)7-14-15-12(8-18(14)16(13)19)6-9(2)11(4)17-15;1-2/h6-7H,2,4-5,8H2,1,3H3;1-2H3 |
| InChIKey | NQDFYNNHXRCILQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one?
The IUPAC name of ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one (CID 171092267) is ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one.
What is the SMILES notation for ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one?
The canonical SMILES for ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one is C=c1cc2c(nc1=C)-c1cc(C)c(CC)c(=O)n1C2.CC.
What is the InChIKey of ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one?
The InChIKey is NQDFYNNHXRCILQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O.C2H6/c1-5-13-10(3)7-14-15-12(8-18(14)16(13)19)6-9(2)11(4)17-15;1-2/h6-7H,2,4-5,8H2,1,3H3;1-2H3.
What are the key properties of ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one?
ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one has a molecular weight of 282.39 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-ethyl-9-methyl-2,3-dimethylidene-5H-pyrido[2,3-a]indolizin-7-one is sourced from PubChem (CID 171092267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).