About 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine
5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine (PubChem CID 171092940) has the molecular formula C10H13F3N2S
and a molecular weight of 250.29 g/mol. Its IUPAC name is 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine.
Molecular Properties
| Compound Name | 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine |
| PubChem CID | 171092940 |
| Molecular Formula | C10H13F3N2S |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine |
| SMILES | C=Cc1cnc(C(F)(F)F)s1.CC1CNC1 |
| InChI | InChI=1S/C6H4F3NS.C4H9N/c1-2-4-3-10-5(11-4)6(7,8)9;1-4-2-5-3-4/h2-3H,1H2;4-5H,2-3H2,1H3 |
| InChIKey | TUHLKULLJQRXPB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine?
The IUPAC name of 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine (CID 171092940) is 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine.
What is the SMILES notation for 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine?
The canonical SMILES for 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine is C=Cc1cnc(C(F)(F)F)s1.CC1CNC1.
What is the InChIKey of 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine?
The InChIKey is TUHLKULLJQRXPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NS.C4H9N/c1-2-4-3-10-5(11-4)6(7,8)9;1-4-2-5-3-4/h2-3H,1H2;4-5H,2-3H2,1H3.
What are the key properties of 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine?
5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine has a molecular weight of 250.29 g/mol, XLogP of 3.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-2-(trifluoromethyl)-1,3-thiazole;3-methylazetidine is sourced from PubChem (CID 171092940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).