C19H22F3NO3 — CID 171093124
tert-butyl 3-[4-(trifluoromethyl)phenyl]-1-oxa-7-azaspiro[4.4]non-2-ene-7-carboxylate (PubChem CID 171093124) has the molecular formula C19H22F3NO3 and a molecular weight of 369.38 g/mol. Its IUPAC name is tert-butyl 3-[4-(trifluoromethyl)phenyl]-1-oxa-7-azaspiro[4.4]non-2-ene-7-carboxylate.
| Compound Name | tert-butyl 3-[4-(trifluoromethyl)phenyl]-1-oxa-7-azaspiro[4.4]non-2-ene-7-carboxylate |
|---|---|
| PubChem CID | 171093124 |
| Molecular Formula | C19H22F3NO3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | tert-butyl 3-[4-(trifluoromethyl)phenyl]-1-oxa-7-azaspiro[4.4]non-2-ene-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC(c3ccc(C(F)(F)F)cc3)=CO2)C1 |
| InChI | InChI=1S/C19H22F3NO3/c1-17(2,3)26-16(24)23-9-8-18(12-23)10-14(11-25-18)13-4-6-15(7-5-13)19(20,21)22/h4-7,11H,8-10,12H2,1-3H3 |
| InChIKey | JCLIXXKSRHRPKY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |