C13H14F3NO — CID 171093195
3-[4-methyl-5-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]furan-2-yl]azetidine (PubChem CID 171093195) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-[4-methyl-5-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]furan-2-yl]azetidine.
| Compound Name | 3-[4-methyl-5-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]furan-2-yl]azetidine |
|---|---|
| PubChem CID | 171093195 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3-[4-methyl-5-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]furan-2-yl]azetidine |
| SMILES | C=C/C(=C\c1oc(C2CNC2)cc1C)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO/c1-3-10(13(14,15)16)5-11-8(2)4-12(18-11)9-6-17-7-9/h3-5,9,17H,1,6-7H2,2H3/b10-5+ |
| InChIKey | KVMPHKBZAIREEA-BJMVGYQFSA-N |
| XLogP | 3.41 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|