C30H31F6N3O2 — CID 171093230
N-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]-4-(4-phenylbutyl)piperazine-1-carboxamide (PubChem CID 171093230) has the molecular formula C30H31F6N3O2 and a molecular weight of 579.59 g/mol. Its IUPAC name is N-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]-4-(4-phenylbutyl)piperazine-1-carboxamide.
| Compound Name | N-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]-4-(4-phenylbutyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 171093230 |
| Molecular Formula | C30H31F6N3O2 |
| Molecular Weight | 579.59 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | N-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]-4-(4-phenylbutyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)N1CCN(CCCCc2ccccc2)CC1 |
| InChI | InChI=1S/C30H31F6N3O2/c31-29(32,33)24-18-23(19-25(20-24)30(34,35)36)21-41-27-11-9-26(10-12-27)37-28(40)39-16-14-38(15-17-39)13-5-4-8-22-6-2-1-3-7-22/h1-3,6-7,9-12,18-20H,4-5,8,13-17,21H2,(H,37,40) |
| InChIKey | RJESQVMCCLVXJV-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.59 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|