C25H36 — CID 171093255
1-[(4E,6E)-5,7-ditert-butyl-3-methylidenenona-4,6,8-trienyl]-4-methylbenzene (PubChem CID 171093255) has the molecular formula C25H36 and a molecular weight of 336.56 g/mol. Its IUPAC name is 1-[(4E,6E)-5,7-ditert-butyl-3-methylidenenona-4,6,8-trienyl]-4-methylbenzene.
| Compound Name | 1-[(4E,6E)-5,7-ditert-butyl-3-methylidenenona-4,6,8-trienyl]-4-methylbenzene |
|---|---|
| PubChem CID | 171093255 |
| Molecular Formula | C25H36 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 1-[(4E,6E)-5,7-ditert-butyl-3-methylidenenona-4,6,8-trienyl]-4-methylbenzene |
| SMILES | C=C/C(=C\C(=C/C(=C)CCc1ccc(C)cc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C25H36/c1-10-22(24(4,5)6)18-23(25(7,8)9)17-20(3)13-16-21-14-11-19(2)12-15-21/h10-12,14-15,17-18H,1,3,13,16H2,2,4-9H3/b22-18+,23-17+ |
| InChIKey | FRHYZHUGEQJGRH-IQMWNNPESA-N |
| XLogP | 7.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|