About but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane
but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane (PubChem CID 171094606) has the molecular formula C20H33N3O3
and a molecular weight of 363.50 g/mol. Its IUPAC name is but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane.
Molecular Properties
| Compound Name | but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane |
| PubChem CID | 171094606 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane |
| SMILES | C=CCC.CCCCC(C)CC.COc1cc([N+](=O)[O-])c(C#N)nc1C |
| InChI | InChI=1S/C8H7N3O3.C8H18.C4H8/c1-5-8(14-2)3-7(11(12)13)6(4-9)10-5;1-4-6-7-8(3)5-2;1-3-4-2/h3H,1-2H3;8H,4-7H2,1-3H3;3H,1,4H2,2H3 |
| InChIKey | NKYIEXUWCSTHLL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 89.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane?
The IUPAC name of but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane (CID 171094606) is but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane.
What is the SMILES notation for but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane?
The canonical SMILES for but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane is C=CCC.CCCCC(C)CC.COc1cc([N+](=O)[O-])c(C#N)nc1C.
What is the InChIKey of but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane?
The InChIKey is NKYIEXUWCSTHLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3.C8H18.C4H8/c1-5-8(14-2)3-7(11(12)13)6(4-9)10-5;1-4-6-7-8(3)5-2;1-3-4-2/h3H,1-2H3;8H,4-7H2,1-3H3;3H,1,4H2,2H3.
What are the key properties of but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane?
but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane has a molecular weight of 363.50 g/mol, XLogP of 5.98, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;3-methylheptane is sourced from PubChem (CID 171094606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).