C23H37N5O3 — CID 171094728
tert-butyl 4-[(3Z,5Z,7E)-6-cyano-7-(dimethylaminomethylideneamino)-5-methoxynona-3,5,7-trien-4-yl]piperazine-1-carboxylate (PubChem CID 171094728) has the molecular formula C23H37N5O3 and a molecular weight of 431.58 g/mol. Its IUPAC name is tert-butyl 4-[(3Z,5Z,7E)-6-cyano-7-(dimethylaminomethylideneamino)-5-methoxynona-3,5,7-trien-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3Z,5Z,7E)-6-cyano-7-(dimethylaminomethylideneamino)-5-methoxynona-3,5,7-trien-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171094728 |
| Molecular Formula | C23H37N5O3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | tert-butyl 4-[(3Z,5Z,7E)-6-cyano-7-(dimethylaminomethylideneamino)-5-methoxynona-3,5,7-trien-4-yl]piperazine-1-carboxylate |
| SMILES | C/C=C(/N=C/N(C)C)C(\C#N)=C(OC)/C(=C/CC)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H37N5O3/c1-9-11-20(21(30-8)18(16-24)19(10-2)25-17-26(6)7)27-12-14-28(15-13-27)22(29)31-23(3,4)5/h10-11,17H,9,12-15H2,1-8H3/b19-10+,20-11-,21-18+,25-17+ |
| InChIKey | SWXHJGBLUAMAEC-DZTHOXNSSA-N |
| XLogP | 3.75 |
| TPSA | 81.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|