About (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile
(2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile (PubChem CID 171094757) has the molecular formula C14H21N3O2
and a molecular weight of 263.34 g/mol. Its IUPAC name is (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile |
| PubChem CID | 171094757 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile |
| SMILES | C=C(/C=C(C#N)\C(=C/C)[N+](=O)[O-])N(CC)CC(C)C |
| InChI | InChI=1S/C14H21N3O2/c1-6-14(17(18)19)13(9-15)8-12(5)16(7-2)10-11(3)4/h6,8,11H,5,7,10H2,1-4H3/b13-8-,14-6+ |
| InChIKey | VSHKRHAKKZDIQU-QDDJFMGRSA-N |
| XLogP | 3.11 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile?
The IUPAC name of (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile (CID 171094757) is (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile.
What is the SMILES notation for (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile?
The canonical SMILES for (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile is C=C(/C=C(C#N)\C(=C/C)[N+](=O)[O-])N(CC)CC(C)C.
What is the InChIKey of (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile?
The InChIKey is VSHKRHAKKZDIQU-QDDJFMGRSA-N. The full InChI is InChI=1S/C14H21N3O2/c1-6-14(17(18)19)13(9-15)8-12(5)16(7-2)10-11(3)4/h6,8,11H,5,7,10H2,1-4H3/b13-8-,14-6+.
What are the key properties of (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile?
(2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile has a molecular weight of 263.34 g/mol, XLogP of 3.11, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-[ethyl(2-methylpropyl)amino]-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienenitrile is sourced from PubChem (CID 171094757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).