About 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene
5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene (PubChem CID 171095017) has the molecular formula C18H27N3O3
and a molecular weight of 333.43 g/mol. Its IUPAC name is 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene.
Molecular Properties
| Compound Name | 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene |
| PubChem CID | 171095017 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene |
| SMILES | C=CCCCCC(C)CC.COc1cc([N+](=O)[O-])c(C#N)nc1C |
| InChI | InChI=1S/C10H20.C8H7N3O3/c1-4-6-7-8-9-10(3)5-2;1-5-8(14-2)3-7(11(12)13)6(4-9)10-5/h4,10H,1,5-9H2,2-3H3;3H,1-2H3 |
| InChIKey | SZYZLWVZWHTHRW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 89.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene?
The IUPAC name of 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene (CID 171095017) is 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene.
What is the SMILES notation for 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene?
The canonical SMILES for 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene is C=CCCCCC(C)CC.COc1cc([N+](=O)[O-])c(C#N)nc1C.
What is the InChIKey of 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene?
The InChIKey is SZYZLWVZWHTHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.C8H7N3O3/c1-4-6-7-8-9-10(3)5-2;1-5-8(14-2)3-7(11(12)13)6(4-9)10-5/h4,10H,1,5-9H2,2-3H3;3H,1-2H3.
What are the key properties of 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene?
5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene has a molecular weight of 333.43 g/mol, XLogP of 4.96, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-6-methyl-3-nitropyridine-2-carbonitrile;7-methylnon-1-ene is sourced from PubChem (CID 171095017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).