C20H31N4O3+ — CID 171095484
tert-butyl 1-[(3Z,5Z,7E)-7-amino-6-cyano-5-methoxynona-3,5,7-trien-4-yl]-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate (PubChem CID 171095484) has the molecular formula C20H31N4O3+ and a molecular weight of 375.49 g/mol. Its IUPAC name is tert-butyl 1-[(3Z,5Z,7E)-7-amino-6-cyano-5-methoxynona-3,5,7-trien-4-yl]-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate.
| Compound Name | tert-butyl 1-[(3Z,5Z,7E)-7-amino-6-cyano-5-methoxynona-3,5,7-trien-4-yl]-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 171095484 |
| Molecular Formula | C20H31N4O3+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | tert-butyl 1-[(3Z,5Z,7E)-7-amino-6-cyano-5-methoxynona-3,5,7-trien-4-yl]-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate |
| SMILES | C/C=C(N)\C(C#N)=C(OC)/C(=C/CC)[N+]1=CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H31N4O3/c1-7-9-17(18(26-6)15(14-21)16(22)8-2)23-10-12-24(13-11-23)19(25)27-20(3,4)5/h8-10H,7,11-13,22H2,1-6H3/q+1/b16-8+,17-9-,18-15+ |
| InChIKey | PBZAKWMAXRBKBC-HPTMEHQCSA-N |
| XLogP | 2.90 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|