C23H30FN3O5S — CID 171096577
(2S)-3-(6-fluoro-2,3-dimethylphenyl)-2-[9-(methoxymethyl)-7-methyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]butanehydrazide (PubChem CID 171096577) has the molecular formula C23H30FN3O5S and a molecular weight of 479.57 g/mol. Its IUPAC name is (2S)-3-(6-fluoro-2,3-dimethylphenyl)-2-[9-(methoxymethyl)-7-methyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]butanehydrazide.
| Compound Name | (2S)-3-(6-fluoro-2,3-dimethylphenyl)-2-[9-(methoxymethyl)-7-methyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]butanehydrazide |
|---|---|
| PubChem CID | 171096577 |
| Molecular Formula | C23H30FN3O5S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (2S)-3-(6-fluoro-2,3-dimethylphenyl)-2-[9-(methoxymethyl)-7-methyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]butanehydrazide |
| SMILES | COCc1cc(C)cc2c1S(=O)(=O)N([C@H](C(=O)NN)C(C)c1c(F)ccc(C)c1C)CCO2 |
| InChI | InChI=1S/C23H30FN3O5S/c1-13-10-17(12-31-5)22-19(11-13)32-9-8-27(33(22,29)30)21(23(28)26-25)16(4)20-15(3)14(2)6-7-18(20)24/h6-7,10-11,16,21H,8-9,12,25H2,1-5H3,(H,26,28)/t16?,21-/m0/s1 |
| InChIKey | URTLALQZXNIWOH-MRNPHLECSA-N |
| XLogP | 2.44 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|