C24H27ClFN5O4S — CID 171096639
6-chloro-2-[2-(6-fluoro-2,3-dimethylphenyl)-1-(2-methylidene-3H-1,3,4-oxadiazol-5-yl)propyl]-4-(oxetan-3-ylmethyl)-3H-pyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide (PubChem CID 171096639) has the molecular formula C24H27ClFN5O4S and a molecular weight of 536.03 g/mol. Its IUPAC name is 6-chloro-2-[2-(6-fluoro-2,3-dimethylphenyl)-1-(2-methylidene-3H-1,3,4-oxadiazol-5-yl)propyl]-4-(oxetan-3-ylmethyl)-3H-pyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide.
| Compound Name | 6-chloro-2-[2-(6-fluoro-2,3-dimethylphenyl)-1-(2-methylidene-3H-1,3,4-oxadiazol-5-yl)propyl]-4-(oxetan-3-ylmethyl)-3H-pyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 171096639 |
| Molecular Formula | C24H27ClFN5O4S |
| Molecular Weight | 536.03 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | 6-chloro-2-[2-(6-fluoro-2,3-dimethylphenyl)-1-(2-methylidene-3H-1,3,4-oxadiazol-5-yl)propyl]-4-(oxetan-3-ylmethyl)-3H-pyrido[2,3-e][1,2,4]thiadiazine 1,1-dioxide |
| SMILES | C=C1NN=C(C(C(C)c2c(F)ccc(C)c2C)N2CN(CC3COC3)c3nc(Cl)ccc3S2(=O)=O)O1 |
| InChI | InChI=1S/C24H27ClFN5O4S/c1-13-5-6-18(26)21(14(13)2)15(3)22(24-29-28-16(4)35-24)31-12-30(9-17-10-34-11-17)23-19(36(31,32)33)7-8-20(25)27-23/h5-8,15,17,22,28H,4,9-12H2,1-3H3 |
| InChIKey | INJYXUIUKZIRSF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.03 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|