C18H23BrClFOS — CID 171096732
1-(3-bromo-6-chloro-2-fluorophenyl)ethanone;ethane;(2E,3Z)-2-ethylidenehexa-3,5-diene-1-thiol (PubChem CID 171096732) has the molecular formula C18H23BrClFOS and a molecular weight of 421.80 g/mol. Its IUPAC name is 1-(3-bromo-6-chloro-2-fluorophenyl)ethanone;ethane;(2E,3Z)-2-ethylidenehexa-3,5-diene-1-thiol.
| Compound Name | 1-(3-bromo-6-chloro-2-fluorophenyl)ethanone;ethane;(2E,3Z)-2-ethylidenehexa-3,5-diene-1-thiol |
|---|---|
| PubChem CID | 171096732 |
| Molecular Formula | C18H23BrClFOS |
| Molecular Weight | 421.80 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 1-(3-bromo-6-chloro-2-fluorophenyl)ethanone;ethane;(2E,3Z)-2-ethylidenehexa-3,5-diene-1-thiol |
| SMILES | C=C/C=C\C(=C/C)CS.CC.CC(=O)c1c(Cl)ccc(Br)c1F |
| InChI | InChI=1S/C8H5BrClFO.C8H12S.C2H6/c1-4(12)7-6(10)3-2-5(9)8(7)11;1-3-5-6-8(4-2)7-9;1-2/h2-3H,1H3;3-6,9H,1,7H2,2H3;1-2H3/b;6-5-,8-4+; |
| InChIKey | MAMHPNRGSYVKGC-ASQUBNKKSA-N |
| XLogP | 7.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.80 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|