C21H27NO — CID 171096980
cumene;N-[(4-methylphenyl)methyl]cyclopropanecarboxamide (PubChem CID 171096980) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is cumene;N-[(4-methylphenyl)methyl]cyclopropanecarboxamide.
| Compound Name | cumene;N-[(4-methylphenyl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 171096980 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | cumene;N-[(4-methylphenyl)methyl]cyclopropanecarboxamide |
| SMILES | CC(C)c1ccccc1.Cc1ccc(CNC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C12H15NO.C9H12/c1-9-2-4-10(5-3-9)8-13-12(14)11-6-7-11;1-8(2)9-6-4-3-5-7-9/h2-5,11H,6-8H2,1H3,(H,13,14);3-8H,1-2H3 |
| InChIKey | CCJLXKCJVKQSCS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |