About ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate
ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate (PubChem CID 171097146) has the molecular formula C12H21F3N2O3
and a molecular weight of 298.31 g/mol. Its IUPAC name is ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate |
| PubChem CID | 171097146 |
| Molecular Formula | C12H21F3N2O3 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate |
| SMILES | CC.CCCN1CCN(C(=O)OCC(F)(F)F)CC1=O |
| InChI | InChI=1S/C10H15F3N2O3.C2H6/c1-2-3-14-4-5-15(6-8(14)16)9(17)18-7-10(11,12)13;1-2/h2-7H2,1H3;1-2H3 |
| InChIKey | CVLCJYCHDATSKN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate?
The IUPAC name of ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate (CID 171097146) is ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate.
What is the SMILES notation for ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate?
The canonical SMILES for ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate is CC.CCCN1CCN(C(=O)OCC(F)(F)F)CC1=O.
What is the InChIKey of ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate?
The InChIKey is CVLCJYCHDATSKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3N2O3.C2H6/c1-2-3-14-4-5-15(6-8(14)16)9(17)18-7-10(11,12)13;1-2/h2-7H2,1H3;1-2H3.
What are the key properties of ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate?
ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate has a molecular weight of 298.31 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,2,2-trifluoroethyl 3-oxo-4-propylpiperazine-1-carboxylate is sourced from PubChem (CID 171097146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).