C6H7F2N3 — CID 171097232
3-(difluoromethyl)-4-prop-2-enyl-1,2,4-triazole (PubChem CID 171097232) has the molecular formula C6H7F2N3 and a molecular weight of 159.14 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(difluoromethyl)-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 171097232 |
| Molecular Formula | C6H7F2N3 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | 3-(difluoromethyl)-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1cnnc1C(F)F |
| InChI | InChI=1S/C6H7F2N3/c1-2-3-11-4-9-10-6(11)5(7)8/h2,4-5H,1,3H2 |
| InChIKey | PPRYZLBVMIZFTC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|