C29H44N6 — CID 171097235
2,5-dimethylidene-1-prop-2-enylimidazolidine;(2E)-2-ethenyl-N-[1-(1-methylpyrrolidin-2-yl)ethenyl]penta-2,4-dien-1-amine;phenylmethanediamine (PubChem CID 171097235) has the molecular formula C29H44N6 and a molecular weight of 476.71 g/mol. Its IUPAC name is 2,5-dimethylidene-1-prop-2-enylimidazolidine;(2E)-2-ethenyl-N-[1-(1-methylpyrrolidin-2-yl)ethenyl]penta-2,4-dien-1-amine;phenylmethanediamine.
| Compound Name | 2,5-dimethylidene-1-prop-2-enylimidazolidine;(2E)-2-ethenyl-N-[1-(1-methylpyrrolidin-2-yl)ethenyl]penta-2,4-dien-1-amine;phenylmethanediamine |
|---|---|
| PubChem CID | 171097235 |
| Molecular Formula | C29H44N6 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.36 |
| IUPAC Name | 2,5-dimethylidene-1-prop-2-enylimidazolidine;(2E)-2-ethenyl-N-[1-(1-methylpyrrolidin-2-yl)ethenyl]penta-2,4-dien-1-amine;phenylmethanediamine |
| SMILES | C=C/C=C(\C=C)CNC(=C)C1CCCN1C.C=CCN1C(=C)CNC1=C.NC(N)c1ccccc1 |
| InChI | InChI=1S/C14H22N2.C8H12N2.C7H10N2/c1-5-8-13(6-2)11-15-12(3)14-9-7-10-16(14)4;1-4-5-10-7(2)6-9-8(10)3;8-7(9)6-4-2-1-3-5-6/h5-6,8,14-15H,1-3,7,9-11H2,4H3;4,9H,1-3,5-6H2;1-5,7H,8-9H2/b13-8+;; |
| InChIKey | IDJJZBQKRCULID-LIYVDSPJSA-N |
| XLogP | 4.15 |
| TPSA | 82.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|