C16H32N6O6 — CID 171097444
ethyl 2-[[(Z)-3-[2-[(E)-1-amino-2-[amino-(2-ethoxy-2-oxoethyl)amino]ethenoxy]ethoxy]-2-(2-methylhydrazinyl)prop-1-enyl]amino]acetate (PubChem CID 171097444) has the molecular formula C16H32N6O6 and a molecular weight of 404.47 g/mol. Its IUPAC name is ethyl 2-[[(Z)-3-[2-[(E)-1-amino-2-[amino-(2-ethoxy-2-oxoethyl)amino]ethenoxy]ethoxy]-2-(2-methylhydrazinyl)prop-1-enyl]amino]acetate.
| Compound Name | ethyl 2-[[(Z)-3-[2-[(E)-1-amino-2-[amino-(2-ethoxy-2-oxoethyl)amino]ethenoxy]ethoxy]-2-(2-methylhydrazinyl)prop-1-enyl]amino]acetate |
|---|---|
| PubChem CID | 171097444 |
| Molecular Formula | C16H32N6O6 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | ethyl 2-[[(Z)-3-[2-[(E)-1-amino-2-[amino-(2-ethoxy-2-oxoethyl)amino]ethenoxy]ethoxy]-2-(2-methylhydrazinyl)prop-1-enyl]amino]acetate |
| SMILES | CCOC(=O)CN/C=C(/COCCO/C(N)=C/N(N)CC(=O)OCC)NNC |
| InChI | InChI=1S/C16H32N6O6/c1-4-26-15(23)9-20-8-13(21-19-3)12-25-6-7-28-14(17)10-22(18)11-16(24)27-5-2/h8,10,19-21H,4-7,9,11-12,17-18H2,1-3H3/b13-8-,14-10+ |
| InChIKey | XTZZIKBLPIQJED-BXIAMOKOSA-N |
| XLogP | -1.77 |
| TPSA | 162.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|