About ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene
ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene (PubChem CID 171097729) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene.
Molecular Properties
| Compound Name | ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene |
| PubChem CID | 171097729 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene |
| SMILES | C=O.CC.CC[C@H](C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C12H18O.C2H6.CH2O/c1-4-10(2)9-11-5-7-12(13-3)8-6-11;2*1-2/h5-8,10H,4,9H2,1-3H3;1-2H3;1H2/t10-;;/m0../s1 |
| InChIKey | ZQRNGPNBONAFSD-XRIOVQLTSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene?
The IUPAC name of ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene (CID 171097729) is ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene.
What is the SMILES notation for ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene?
The canonical SMILES for ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene is C=O.CC.CC[C@H](C)Cc1ccc(OC)cc1.
What is the InChIKey of ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene?
The InChIKey is ZQRNGPNBONAFSD-XRIOVQLTSA-N. The full InChI is InChI=1S/C12H18O.C2H6.CH2O/c1-4-10(2)9-11-5-7-12(13-3)8-6-11;2*1-2/h5-8,10H,4,9H2,1-3H3;1-2H3;1H2/t10-;;/m0../s1.
What are the key properties of ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene?
ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene has a molecular weight of 238.37 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formaldehyde;1-methoxy-4-[(2S)-2-methylbutyl]benzene is sourced from PubChem (CID 171097729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).