C24H22F3N5O3 — CID 171098106
6-[[(4R,6R)-6-(difluoromethyl)-12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-4,5-dimethylpyridine-3-carbaldehyde (PubChem CID 171098106) has the molecular formula C24H22F3N5O3 and a molecular weight of 485.47 g/mol. Its IUPAC name is 6-[[(4R,6R)-6-(difluoromethyl)-12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-4,5-dimethylpyridine-3-carbaldehyde.
| Compound Name | 6-[[(4R,6R)-6-(difluoromethyl)-12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-4,5-dimethylpyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 171098106 |
| Molecular Formula | C24H22F3N5O3 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 6-[[(4R,6R)-6-(difluoromethyl)-12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-4,5-dimethylpyridine-3-carbaldehyde |
| SMILES | Cc1c(C=O)cnc(O[C@H]2CN3c4cc(-c5cccc(F)c5O)nnc4NC[C@@]3(C(F)F)C2)c1C |
| InChI | InChI=1S/C24H22F3N5O3/c1-12-13(2)22(28-8-14(12)10-33)35-15-7-24(23(26)27)11-29-21-19(32(24)9-15)6-18(30-31-21)16-4-3-5-17(25)20(16)34/h3-6,8,10,15,23,34H,7,9,11H2,1-2H3,(H,29,31)/t15-,24-/m1/s1 |
| InChIKey | ICNPSFWIEZFJSW-OYLFLEFRSA-N |
| XLogP | 3.90 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|