C23H22F2N6O2 — CID 171098111
2-[(4R,6R)-4-(5-ethenyl-3-methylpyrazin-2-yl)oxy-6-(fluoromethyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-fluorophenol (PubChem CID 171098111) has the molecular formula C23H22F2N6O2 and a molecular weight of 452.47 g/mol. Its IUPAC name is 2-[(4R,6R)-4-(5-ethenyl-3-methylpyrazin-2-yl)oxy-6-(fluoromethyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-fluorophenol.
| Compound Name | 2-[(4R,6R)-4-(5-ethenyl-3-methylpyrazin-2-yl)oxy-6-(fluoromethyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-fluorophenol |
|---|---|
| PubChem CID | 171098111 |
| Molecular Formula | C23H22F2N6O2 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-[(4R,6R)-4-(5-ethenyl-3-methylpyrazin-2-yl)oxy-6-(fluoromethyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-fluorophenol |
| SMILES | C=Cc1cnc(O[C@H]2CN3c4cc(-c5cccc(F)c5O)nnc4NC[C@@]3(CF)C2)c(C)n1 |
| InChI | InChI=1S/C23H22F2N6O2/c1-3-14-9-26-22(13(2)28-14)33-15-8-23(11-24)12-27-21-19(31(23)10-15)7-18(29-30-21)16-5-4-6-17(25)20(16)32/h3-7,9,15,32H,1,8,10-12H2,2H3,(H,27,30)/t15-,23+/m1/s1 |
| InChIKey | BMQIIGUOBXGQPW-CMJOXMDJSA-N |
| XLogP | 3.52 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |