C23H23FN6O3 — CID 171098127
5-[[(4R,6R)-6-ethyl-12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-3-methylpyrazine-2-carbaldehyde (PubChem CID 171098127) has the molecular formula C23H23FN6O3 and a molecular weight of 450.47 g/mol. Its IUPAC name is 5-[[(4R,6R)-6-ethyl-12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-3-methylpyrazine-2-carbaldehyde.
| Compound Name | 5-[[(4R,6R)-6-ethyl-12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-3-methylpyrazine-2-carbaldehyde |
|---|---|
| PubChem CID | 171098127 |
| Molecular Formula | C23H23FN6O3 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 5-[[(4R,6R)-6-ethyl-12-(3-fluoro-2-hydroxyphenyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-3-methylpyrazine-2-carbaldehyde |
| SMILES | CC[C@@]12CNc3nnc(-c4cccc(F)c4O)cc3N1C[C@H](Oc1cnc(C=O)c(C)n1)C2 |
| InChI | InChI=1S/C23H23FN6O3/c1-3-23-8-14(33-20-9-25-18(11-31)13(2)27-20)10-30(23)19-7-17(28-29-22(19)26-12-23)15-5-4-6-16(24)21(15)32/h4-7,9,11,14,32H,3,8,10,12H2,1-2H3,(H,26,29)/t14-,23-/m1/s1 |
| InChIKey | HHSBUCWDLCAOGA-QKFKETGDSA-N |
| XLogP | 3.13 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|