C22H21FN6O3 — CID 171098146
5-[[12-(3-fluoro-2-hydroxyphenyl)-6-methyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-6-methylpyrazine-2-carbaldehyde (PubChem CID 171098146) has the molecular formula C22H21FN6O3 and a molecular weight of 436.45 g/mol. Its IUPAC name is 5-[[12-(3-fluoro-2-hydroxyphenyl)-6-methyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-6-methylpyrazine-2-carbaldehyde.
| Compound Name | 5-[[12-(3-fluoro-2-hydroxyphenyl)-6-methyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-6-methylpyrazine-2-carbaldehyde |
|---|---|
| PubChem CID | 171098146 |
| Molecular Formula | C22H21FN6O3 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 5-[[12-(3-fluoro-2-hydroxyphenyl)-6-methyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-6-methylpyrazine-2-carbaldehyde |
| SMILES | Cc1nc(C=O)cnc1OC1CN2c3cc(-c4cccc(F)c4O)nnc3NCC2(C)C1 |
| InChI | InChI=1S/C22H21FN6O3/c1-12-21(24-8-13(10-30)26-12)32-14-7-22(2)11-25-20-18(29(22)9-14)6-17(27-28-20)15-4-3-5-16(23)19(15)31/h3-6,8,10,14,31H,7,9,11H2,1-2H3,(H,25,28) |
| InChIKey | CHPWZIGXFOUYHP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|