C22H20F2N6O3 — CID 171098206
5-[[(4R,6R)-12-(3-fluoro-2-hydroxyphenyl)-6-(fluoromethyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-6-methylpyrazine-2-carbaldehyde (PubChem CID 171098206) has the molecular formula C22H20F2N6O3 and a molecular weight of 454.44 g/mol. Its IUPAC name is 5-[[(4R,6R)-12-(3-fluoro-2-hydroxyphenyl)-6-(fluoromethyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-6-methylpyrazine-2-carbaldehyde.
| Compound Name | 5-[[(4R,6R)-12-(3-fluoro-2-hydroxyphenyl)-6-(fluoromethyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-6-methylpyrazine-2-carbaldehyde |
|---|---|
| PubChem CID | 171098206 |
| Molecular Formula | C22H20F2N6O3 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 5-[[(4R,6R)-12-(3-fluoro-2-hydroxyphenyl)-6-(fluoromethyl)-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]oxy]-6-methylpyrazine-2-carbaldehyde |
| SMILES | Cc1nc(C=O)cnc1O[C@H]1CN2c3cc(-c4cccc(F)c4O)nnc3NC[C@@]2(CF)C1 |
| InChI | InChI=1S/C22H20F2N6O3/c1-12-21(25-7-13(9-31)27-12)33-14-6-22(10-23)11-26-20-18(30(22)8-14)5-17(28-29-20)15-3-2-4-16(24)19(15)32/h2-5,7,9,14,32H,6,8,10-11H2,1H3,(H,26,29)/t14-,22+/m1/s1 |
| InChIKey | PJJWRWTVUCIFME-PEBXRYMYSA-N |
| XLogP | 2.69 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|