C27H31N5O2 — CID 171098243
2-[(4R,6R)-4-[(6-ethenyl-4,5-dimethyl-3-pyridinyl)oxy]-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-methylphenol (PubChem CID 171098243) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 2-[(4R,6R)-4-[(6-ethenyl-4,5-dimethyl-3-pyridinyl)oxy]-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-methylphenol.
| Compound Name | 2-[(4R,6R)-4-[(6-ethenyl-4,5-dimethyl-3-pyridinyl)oxy]-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-methylphenol |
|---|---|
| PubChem CID | 171098243 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 2-[(4R,6R)-4-[(6-ethenyl-4,5-dimethyl-3-pyridinyl)oxy]-6-ethyl-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-yl]-6-methylphenol |
| SMILES | C=Cc1ncc(O[C@H]2CN3c4cc(-c5cccc(C)c5O)nnc4NC[C@@]3(CC)C2)c(C)c1C |
| InChI | InChI=1S/C27H31N5O2/c1-6-21-17(4)18(5)24(13-28-21)34-19-12-27(7-2)15-29-26-23(32(27)14-19)11-22(30-31-26)20-10-8-9-16(3)25(20)33/h6,8-11,13,19,33H,1,7,12,14-15H2,2-5H3,(H,29,31)/t19-,27-/m1/s1 |
| InChIKey | PYXMLBJVQOVJPC-XHCCPWGMSA-N |
| XLogP | 5.04 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |