About 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate
2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate (PubChem CID 171098887) has the molecular formula C6H5ClO3S
and a molecular weight of 192.62 g/mol. Its IUPAC name is 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate.
Molecular Properties
| Compound Name | 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate |
| PubChem CID | 171098887 |
| Molecular Formula | C6H5ClO3S |
| Molecular Weight | 192.62 g/mol |
| Exact Mass | 191.96 |
| IUPAC Name | 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate |
| SMILES | O.O=CC(=O)c1cc(Cl)cs1 |
| InChI | InChI=1S/C6H3ClO2S.H2O/c7-4-1-6(10-3-4)5(9)2-8;/h1-3H;1H2 |
| InChIKey | MPLUXDOWWGNRFD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 65.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.62 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate?
The IUPAC name of 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate (CID 171098887) is 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate.
What is the SMILES notation for 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate?
The canonical SMILES for 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate is O.O=CC(=O)c1cc(Cl)cs1.
What is the InChIKey of 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate?
The InChIKey is MPLUXDOWWGNRFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClO2S.H2O/c7-4-1-6(10-3-4)5(9)2-8;/h1-3H;1H2.
What are the key properties of 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate?
2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate has a molecular weight of 192.62 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorothiophen-2-yl)-2-oxoacetaldehyde;hydrate is sourced from PubChem (CID 171098887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).