C18H14N4S — CID 171099009
6-methylsulfanyl-1,3-diphenylpyrazolo[3,4-d]pyrimidine (PubChem CID 171099009) has the molecular formula C18H14N4S and a molecular weight of 318.41 g/mol. Its IUPAC name is 6-methylsulfanyl-1,3-diphenylpyrazolo[3,4-d]pyrimidine.
| Compound Name | 6-methylsulfanyl-1,3-diphenylpyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 171099009 |
| Molecular Formula | C18H14N4S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 6-methylsulfanyl-1,3-diphenylpyrazolo[3,4-d]pyrimidine |
| SMILES | CSc1ncc2c(-c3ccccc3)nn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C18H14N4S/c1-23-18-19-12-15-16(13-8-4-2-5-9-13)21-22(17(15)20-18)14-10-6-3-7-11-14/h2-12H,1H3 |
| InChIKey | HYNPPCWHMAOCTJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |