About 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine
8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine (PubChem CID 171099895) has the molecular formula C7H7BrN2S
and a molecular weight of 231.12 g/mol. Its IUPAC name is 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine.
Molecular Properties
| Compound Name | 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine |
| PubChem CID | 171099895 |
| Molecular Formula | C7H7BrN2S |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine |
| SMILES | Brc1cncc2c1SCCN2 |
| InChI | InChI=1S/C7H7BrN2S/c8-5-3-9-4-6-7(5)11-2-1-10-6/h3-4,10H,1-2H2 |
| InChIKey | LLLSFFRMXGGVMM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine?
The IUPAC name of 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine (CID 171099895) is 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine.
What is the SMILES notation for 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine?
The canonical SMILES for 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine is Brc1cncc2c1SCCN2.
What is the InChIKey of 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine?
The InChIKey is LLLSFFRMXGGVMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN2S/c8-5-3-9-4-6-7(5)11-2-1-10-6/h3-4,10H,1-2H2.
What are the key properties of 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine?
8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine has a molecular weight of 231.12 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-3,4-dihydro-2H-pyrido[4,3-b][1,4]thiazine is sourced from PubChem (CID 171099895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).