C11H13F3N4 — CID 171099997
4-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole (PubChem CID 171099997) has the molecular formula C11H13F3N4 and a molecular weight of 258.25 g/mol. Its IUPAC name is 4-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole.
| Compound Name | 4-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 171099997 |
| Molecular Formula | C11H13F3N4 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 4-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole |
| SMILES | FC(F)(F)c1cnc(N2CCC3NCCC32)nc1 |
| InChI | InChI=1S/C11H13F3N4/c12-11(13,14)7-5-16-10(17-6-7)18-4-2-8-9(18)1-3-15-8/h5-6,8-9,15H,1-4H2 |
| InChIKey | NDNSCCRUFWLZNH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |