C20H31F3N4O2 — CID 171100001
1-[(3aS,6aR)-2-[5-(trifluoromethyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-propoxypropan-1-one;propane (PubChem CID 171100001) has the molecular formula C20H31F3N4O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2-[5-(trifluoromethyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-propoxypropan-1-one;propane.
| Compound Name | 1-[(3aS,6aR)-2-[5-(trifluoromethyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-propoxypropan-1-one;propane |
|---|---|
| PubChem CID | 171100001 |
| Molecular Formula | C20H31F3N4O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 1-[(3aS,6aR)-2-[5-(trifluoromethyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-propoxypropan-1-one;propane |
| SMILES | CCC.CCCOCCC(=O)N1C[C@@H]2CN(c3ncc(C(F)(F)F)cn3)C[C@@H]2C1 |
| InChI | InChI=1S/C17H23F3N4O2.C3H8/c1-2-4-26-5-3-15(25)23-8-12-10-24(11-13(12)9-23)16-21-6-14(7-22-16)17(18,19)20;1-3-2/h6-7,12-13H,2-5,8-11H2,1H3;3H2,1-2H3/t12-,13+; |
| InChIKey | YBOMQTZDEOINEM-OEEJBDNKSA-N |
| XLogP | 3.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|