C19H31F3N4OS — CID 171100026
(3aR,6aR)-4-(2-propoxyethylsulfanyl)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;propane (PubChem CID 171100026) has the molecular formula C19H31F3N4OS and a molecular weight of 420.55 g/mol. Its IUPAC name is (3aR,6aR)-4-(2-propoxyethylsulfanyl)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;propane.
| Compound Name | (3aR,6aR)-4-(2-propoxyethylsulfanyl)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;propane |
|---|---|
| PubChem CID | 171100026 |
| Molecular Formula | C19H31F3N4OS |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (3aR,6aR)-4-(2-propoxyethylsulfanyl)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;propane |
| SMILES | CCC.CCCOCCSN1CC[C@@H]2[C@H]1CCN2c1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C16H23F3N4OS.C3H8/c1-2-7-24-8-9-25-23-6-4-13-14(23)3-5-22(13)15-20-10-12(11-21-15)16(17,18)19;1-3-2/h10-11,13-14H,2-9H2,1H3;3H2,1-2H3/t13-,14-;/m1./s1 |
| InChIKey | TVNUWKDNEXCSFS-DTPOWOMPSA-N |
| XLogP | 4.64 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|