C16H23F3N4OS — CID 171100027
(3aR,6aR)-4-(2-propoxyethylsulfanyl)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 171100027) has the molecular formula C16H23F3N4OS and a molecular weight of 376.45 g/mol. Its IUPAC name is (3aR,6aR)-4-(2-propoxyethylsulfanyl)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aR,6aR)-4-(2-propoxyethylsulfanyl)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 171100027 |
| Molecular Formula | C16H23F3N4OS |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (3aR,6aR)-4-(2-propoxyethylsulfanyl)-1-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | CCCOCCSN1CC[C@@H]2[C@H]1CCN2c1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C16H23F3N4OS/c1-2-7-24-8-9-25-23-6-4-13-14(23)3-5-22(13)15-20-10-12(11-21-15)16(17,18)19/h10-11,13-14H,2-9H2,1H3/t13-,14-/m1/s1 |
| InChIKey | GKRNMBFHNYMVAG-ZIAGYGMSSA-N |
| XLogP | 3.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|