C22H33F3N4O2 — CID 171100039
1-[(4aR,8aR)-5-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,4,4a,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-3-(3,3-dimethylbutoxy)propan-1-one (PubChem CID 171100039) has the molecular formula C22H33F3N4O2 and a molecular weight of 442.53 g/mol. Its IUPAC name is 1-[(4aR,8aR)-5-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,4,4a,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-3-(3,3-dimethylbutoxy)propan-1-one.
| Compound Name | 1-[(4aR,8aR)-5-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,4,4a,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-3-(3,3-dimethylbutoxy)propan-1-one |
|---|---|
| PubChem CID | 171100039 |
| Molecular Formula | C22H33F3N4O2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 1-[(4aR,8aR)-5-[5-(trifluoromethyl)pyrimidin-2-yl]-2,3,4,4a,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-3-(3,3-dimethylbutoxy)propan-1-one |
| SMILES | CC(C)(C)CCOCCC(=O)N1CCC[C@@H]2[C@H]1CCCN2c1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C22H33F3N4O2/c1-21(2,3)9-13-31-12-8-19(30)28-10-4-7-18-17(28)6-5-11-29(18)20-26-14-16(15-27-20)22(23,24)25/h14-15,17-18H,4-13H2,1-3H3/t17-,18-/m1/s1 |
| InChIKey | JIJJKTANYMDOGZ-QZTJIDSGSA-N |
| XLogP | 4.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|