C25H32N4O3S — CID 17110031
N-[[4-(4-butanoylpiperazin-1-yl)phenyl]carbamothioyl]-4-propan-2-yloxybenzamide (PubChem CID 17110031) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is N-[[4-(4-butanoylpiperazin-1-yl)phenyl]carbamothioyl]-4-propan-2-yloxybenzamide.
| Compound Name | N-[[4-(4-butanoylpiperazin-1-yl)phenyl]carbamothioyl]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17110031 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | N-[[4-(4-butanoylpiperazin-1-yl)phenyl]carbamothioyl]-4-propan-2-yloxybenzamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3ccc(OC(C)C)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H32N4O3S/c1-4-5-23(30)29-16-14-28(15-17-29)21-10-8-20(9-11-21)26-25(33)27-24(31)19-6-12-22(13-7-19)32-18(2)3/h6-13,18H,4-5,14-17H2,1-3H3,(H2,26,27,31,33) |
| InChIKey | DFRIBEBQEXCTRK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|