C15H16F2IN5O — CID 171100764
trans-(1S,3S)-3-N-[5-(difluoromethoxy)pyrazin-2-yl]-1-N-(5-iodo-2-pyridinyl)cyclopentane-1,3-diamine (PubChem CID 171100764) has the molecular formula C15H16F2IN5O and a molecular weight of 447.23 g/mol. Its IUPAC name is trans-(1S,3S)-3-N-[5-(difluoromethoxy)pyrazin-2-yl]-1-N-(5-iodo-2-pyridinyl)cyclopentane-1,3-diamine.
| Compound Name | trans-(1S,3S)-3-N-[5-(difluoromethoxy)pyrazin-2-yl]-1-N-(5-iodo-2-pyridinyl)cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 171100764 |
| Molecular Formula | C15H16F2IN5O |
| Molecular Weight | 447.23 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | trans-(1S,3S)-3-N-[5-(difluoromethoxy)pyrazin-2-yl]-1-N-(5-iodo-2-pyridinyl)cyclopentane-1,3-diamine |
| SMILES | FC(F)Oc1cnc(N[C@H]2CC[C@H](Nc3ccc(I)cn3)C2)cn1 |
| InChI | InChI=1S/C15H16F2IN5O/c16-15(17)24-14-8-20-13(7-21-14)23-11-3-2-10(5-11)22-12-4-1-9(18)6-19-12/h1,4,6-8,10-11,15H,2-3,5H2,(H,19,22)(H,20,23)/t10-,11-/m0/s1 |
| InChIKey | YNPCJEVZDXMJSB-QWRGUYRKSA-N |
| XLogP | 3.52 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|