C17H18N4O — CID 171100787
ethane;3-methyl-1-(6-methyl-3-pyridinyl)-2-oxobenzimidazole-5-carbonitrile (PubChem CID 171100787) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is ethane;3-methyl-1-(6-methyl-3-pyridinyl)-2-oxobenzimidazole-5-carbonitrile.
| Compound Name | ethane;3-methyl-1-(6-methyl-3-pyridinyl)-2-oxobenzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 171100787 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | ethane;3-methyl-1-(6-methyl-3-pyridinyl)-2-oxobenzimidazole-5-carbonitrile |
| SMILES | CC.Cc1ccc(-n2c(=O)n(C)c3cc(C#N)ccc32)cn1 |
| InChI | InChI=1S/C15H12N4O.C2H6/c1-10-3-5-12(9-17-10)19-13-6-4-11(8-16)7-14(13)18(2)15(19)20;1-2/h3-7,9H,1-2H3;1-2H3 |
| InChIKey | WUTHASLBACCRFP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |