About (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide
(2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide (PubChem CID 171101289) has the molecular formula C6H12N4O
and a molecular weight of 156.19 g/mol. Its IUPAC name is (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide.
Molecular Properties
| Compound Name | (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide |
| PubChem CID | 171101289 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide |
| SMILES | [H]/N=C/C(=N/NC)C(=O)N(C)C |
| InChI | InChI=1S/C6H12N4O/c1-8-9-5(4-7)6(11)10(2)3/h4,7-8H,1-3H3/b7-4+,9-5- |
| InChIKey | LXWBRUJXHOMRMJ-HQHVODAESA-N |
| XLogP | -0.70 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide?
The IUPAC name of (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide (CID 171101289) is (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide.
What is the SMILES notation for (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide?
The canonical SMILES for (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide is [H]/N=C/C(=N/NC)C(=O)N(C)C.
What is the InChIKey of (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide?
The InChIKey is LXWBRUJXHOMRMJ-HQHVODAESA-N. The full InChI is InChI=1S/C6H12N4O/c1-8-9-5(4-7)6(11)10(2)3/h4,7-8H,1-3H3/b7-4+,9-5-.
What are the key properties of (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide?
(2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide has a molecular weight of 156.19 g/mol, XLogP of -0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-imino-N,N-dimethyl-2-(methylhydrazinylidene)propanamide is sourced from PubChem (CID 171101289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).