About [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol
[3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol (PubChem CID 171101927) has the molecular formula C8H15F3N2O
and a molecular weight of 212.21 g/mol. Its IUPAC name is [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol |
| PubChem CID | 171101927 |
| Molecular Formula | C8H15F3N2O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol |
| SMILES | NC1(CO)CCCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C8H15F3N2O/c9-8(10,11)5-13-3-1-2-7(12,4-13)6-14/h14H,1-6,12H2 |
| InChIKey | SMTWQUKPYMUANC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol?
The IUPAC name of [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol (CID 171101927) is [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol.
What is the SMILES notation for [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol?
The canonical SMILES for [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol is NC1(CO)CCCN(CC(F)(F)F)C1.
What is the InChIKey of [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol?
The InChIKey is SMTWQUKPYMUANC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O/c9-8(10,11)5-13-3-1-2-7(12,4-13)6-14/h14H,1-6,12H2.
What are the key properties of [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol?
[3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol has a molecular weight of 212.21 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanol is sourced from PubChem (CID 171101927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).