C18H23F3N5OP — CID 171102683
4-N-(3-dimethylphosphorylphenyl)-2-N-piperidin-3-yl-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 171102683) has the molecular formula C18H23F3N5OP and a molecular weight of 413.38 g/mol. Its IUPAC name is 4-N-(3-dimethylphosphorylphenyl)-2-N-piperidin-3-yl-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-dimethylphosphorylphenyl)-2-N-piperidin-3-yl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 171102683 |
| Molecular Formula | C18H23F3N5OP |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 4-N-(3-dimethylphosphorylphenyl)-2-N-piperidin-3-yl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1cccc(Nc2nc(NC3CCCNC3)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C18H23F3N5OP/c1-28(2,27)14-7-3-5-12(9-14)24-16-15(18(19,20)21)11-23-17(26-16)25-13-6-4-8-22-10-13/h3,5,7,9,11,13,22H,4,6,8,10H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | QQHHNXKUDITIEH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|