C22H23F5N2O2 — CID 17110281
2-(5-methyl-2-propan-2-ylphenoxy)-1-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]ethanone (PubChem CID 17110281) has the molecular formula C22H23F5N2O2 and a molecular weight of 442.43 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-ylphenoxy)-1-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(5-methyl-2-propan-2-ylphenoxy)-1-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 17110281 |
| Molecular Formula | C22H23F5N2O2 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylphenoxy)-1-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)c1 |
| InChI | InChI=1S/C22H23F5N2O2/c1-12(2)14-5-4-13(3)10-15(14)31-11-16(30)28-6-8-29(9-7-28)22-20(26)18(24)17(23)19(25)21(22)27/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | RIGALZHVWUYDHW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|