C20H46O — CID 171102890
ethane;1-methoxy-2,4,5,9,9-pentamethyldecane (PubChem CID 171102890) has the molecular formula C20H46O and a molecular weight of 302.59 g/mol. Its IUPAC name is ethane;1-methoxy-2,4,5,9,9-pentamethyldecane.
| Compound Name | ethane;1-methoxy-2,4,5,9,9-pentamethyldecane |
|---|---|
| PubChem CID | 171102890 |
| Molecular Formula | C20H46O |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 302.35 |
| IUPAC Name | ethane;1-methoxy-2,4,5,9,9-pentamethyldecane |
| SMILES | CC.CC.COCC(C)CC(C)C(C)CCCC(C)(C)C |
| InChI | InChI=1S/C16H34O.2C2H6/c1-13(12-17-7)11-15(3)14(2)9-8-10-16(4,5)6;2*1-2/h13-15H,8-12H2,1-7H3;2*1-2H3 |
| InChIKey | LMIQRWKLJDHPOP-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |