C36H53ClN4O — CID 171105088
6-chloro-15-[1-(2-methylheptyl)piperidin-4-yl]spiro[1,9,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,9,12(17),13,15-heptaene-11,1'-cyclohexane]-8-one;ethane (PubChem CID 171105088) has the molecular formula C36H53ClN4O and a molecular weight of 593.30 g/mol. Its IUPAC name is 6-chloro-15-[1-(2-methylheptyl)piperidin-4-yl]spiro[1,9,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,9,12(17),13,15-heptaene-11,1'-cyclohexane]-8-one;ethane.
| Compound Name | 6-chloro-15-[1-(2-methylheptyl)piperidin-4-yl]spiro[1,9,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,9,12(17),13,15-heptaene-11,1'-cyclohexane]-8-one;ethane |
|---|---|
| PubChem CID | 171105088 |
| Molecular Formula | C36H53ClN4O |
| Molecular Weight | 593.30 g/mol |
| Exact Mass | 592.39 |
| IUPAC Name | 6-chloro-15-[1-(2-methylheptyl)piperidin-4-yl]spiro[1,9,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,9,12(17),13,15-heptaene-11,1'-cyclohexane]-8-one;ethane |
| SMILES | CC.CC.CCCCCC(C)CN1CCC(c2ccc3c(n2)-n2c(nc(=O)c4c(Cl)cccc42)C32CCCCC2)CC1 |
| InChI | InChI=1S/C32H41ClN4O.2C2H6/c1-3-4-6-10-22(2)21-36-19-15-23(16-20-36)26-14-13-24-29(34-26)37-27-12-9-11-25(33)28(27)30(38)35-31(37)32(24)17-7-5-8-18-32;2*1-2/h9,11-14,22-23H,3-8,10,15-21H2,1-2H3;2*1-2H3 |
| InChIKey | LNMLAASKRTXZSP-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.30 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|