C35H47ClN6O — CID 171105134
2-[6'-[1-[[4-[(Z)-1-amino-2-hydrazinylethenyl]cyclohexyl]methyl]piperidin-4-yl]-2'-methyliminospiro[cyclohexane-1,3'-indole]-1'-yl]-6-chlorobenzaldehyde (PubChem CID 171105134) has the molecular formula C35H47ClN6O and a molecular weight of 603.26 g/mol. Its IUPAC name is 2-[6'-[1-[[4-[(Z)-1-amino-2-hydrazinylethenyl]cyclohexyl]methyl]piperidin-4-yl]-2'-methyliminospiro[cyclohexane-1,3'-indole]-1'-yl]-6-chlorobenzaldehyde.
| Compound Name | 2-[6'-[1-[[4-[(Z)-1-amino-2-hydrazinylethenyl]cyclohexyl]methyl]piperidin-4-yl]-2'-methyliminospiro[cyclohexane-1,3'-indole]-1'-yl]-6-chlorobenzaldehyde |
|---|---|
| PubChem CID | 171105134 |
| Molecular Formula | C35H47ClN6O |
| Molecular Weight | 603.26 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | 2-[6'-[1-[[4-[(Z)-1-amino-2-hydrazinylethenyl]cyclohexyl]methyl]piperidin-4-yl]-2'-methyliminospiro[cyclohexane-1,3'-indole]-1'-yl]-6-chlorobenzaldehyde |
| SMILES | C/N=C1/N(c2cccc(Cl)c2C=O)c2cc(C3CCN(CC4CCC(/C(N)=C/NN)CC4)CC3)ccc2C12CCCCC2 |
| InChI | InChI=1S/C35H47ClN6O/c1-39-34-35(16-3-2-4-17-35)29-13-12-27(20-33(29)42(34)32-7-5-6-30(36)28(32)23-43)25-14-18-41(19-15-25)22-24-8-10-26(11-9-24)31(37)21-40-38/h5-7,12-13,20-21,23-26,40H,2-4,8-11,14-19,22,37-38H2,1H3/b31-21-,39-34+ |
| InChIKey | DRQFHGNROKVREU-AJQNZDRKSA-N |
| XLogP | 6.78 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.26 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|